C22H27Cl2N3O3S — CID 27024550
1-(2,6-dichlorophenyl)sulfonyl-N-[3-(N-methylanilino)propyl]piperidine-4-carboxamide (PubChem CID 27024550) has the molecular formula C22H27Cl2N3O3S and a molecular weight of 484.45 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)sulfonyl-N-[3-(N-methylanilino)propyl]piperidine-4-carboxamide.
| Compound Name | 1-(2,6-dichlorophenyl)sulfonyl-N-[3-(N-methylanilino)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 27024550 |
| Molecular Formula | C22H27Cl2N3O3S |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 1-(2,6-dichlorophenyl)sulfonyl-N-[3-(N-methylanilino)propyl]piperidine-4-carboxamide |
| SMILES | CN(CCCNC(=O)C1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H27Cl2N3O3S/c1-26(18-7-3-2-4-8-18)14-6-13-25-22(28)17-11-15-27(16-12-17)31(29,30)21-19(23)9-5-10-20(21)24/h2-5,7-10,17H,6,11-16H2,1H3,(H,25,28) |
| InChIKey | OFIDOZVNZZHNFZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|