C24H30F3N3O3S — CID 55397868
N-[3-(N-ethylanilino)propyl]-1-[2-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 55397868) has the molecular formula C24H30F3N3O3S and a molecular weight of 497.58 g/mol. Its IUPAC name is N-[3-(N-ethylanilino)propyl]-1-[2-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-(N-ethylanilino)propyl]-1-[2-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55397868 |
| Molecular Formula | C24H30F3N3O3S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | N-[3-(N-ethylanilino)propyl]-1-[2-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | CCN(CCCNC(=O)C1CCN(S(=O)(=O)c2ccccc2C(F)(F)F)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H30F3N3O3S/c1-2-29(20-9-4-3-5-10-20)16-8-15-28-23(31)19-13-17-30(18-14-19)34(32,33)22-12-7-6-11-21(22)24(25,26)27/h3-7,9-12,19H,2,8,13-18H2,1H3,(H,28,31) |
| InChIKey | LBHLFBLBPLTHKF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|