C23H29Cl2N3O3S — CID 41278246
1-(2,5-dichlorophenyl)sulfonyl-N-[3-(N-ethylanilino)propyl]piperidine-4-carboxamide (PubChem CID 41278246) has the molecular formula C23H29Cl2N3O3S and a molecular weight of 498.48 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-N-[3-(N-ethylanilino)propyl]piperidine-4-carboxamide.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-N-[3-(N-ethylanilino)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 41278246 |
| Molecular Formula | C23H29Cl2N3O3S |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-N-[3-(N-ethylanilino)propyl]piperidine-4-carboxamide |
| SMILES | CCN(CCCNC(=O)C1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H29Cl2N3O3S/c1-2-27(20-7-4-3-5-8-20)14-6-13-26-23(29)18-11-15-28(16-12-18)32(30,31)22-17-19(24)9-10-21(22)25/h3-5,7-10,17-18H,2,6,11-16H2,1H3,(H,26,29) |
| InChIKey | OCNJTAITGFKMCB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|