C15H20Cl2N2O4S — CID 78803662
1-(2,5-dichlorophenyl)sulfonyl-N-(2-hydroxypropyl)piperidine-4-carboxamide (PubChem CID 78803662) has the molecular formula C15H20Cl2N2O4S and a molecular weight of 395.31 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-N-(2-hydroxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-N-(2-hydroxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78803662 |
| Molecular Formula | C15H20Cl2N2O4S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-N-(2-hydroxypropyl)piperidine-4-carboxamide |
| SMILES | CC(O)CNC(=O)C1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C15H20Cl2N2O4S/c1-10(20)9-18-15(21)11-4-6-19(7-5-11)24(22,23)14-8-12(16)2-3-13(14)17/h2-3,8,10-11,20H,4-7,9H2,1H3,(H,18,21) |
| InChIKey | FNUOPNVAKQXMRT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |