C22H28F2N4O3S — CID 55575736
4-(2,5-difluorophenyl)sulfonyl-N-[3-(N-ethylanilino)propyl]piperazine-1-carboxamide (PubChem CID 55575736) has the molecular formula C22H28F2N4O3S and a molecular weight of 466.55 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)sulfonyl-N-[3-(N-ethylanilino)propyl]piperazine-1-carboxamide.
| Compound Name | 4-(2,5-difluorophenyl)sulfonyl-N-[3-(N-ethylanilino)propyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55575736 |
| Molecular Formula | C22H28F2N4O3S |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 4-(2,5-difluorophenyl)sulfonyl-N-[3-(N-ethylanilino)propyl]piperazine-1-carboxamide |
| SMILES | CCN(CCCNC(=O)N1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H28F2N4O3S/c1-2-26(19-7-4-3-5-8-19)12-6-11-25-22(29)27-13-15-28(16-14-27)32(30,31)21-17-18(23)9-10-20(21)24/h3-5,7-10,17H,2,6,11-16H2,1H3,(H,25,29) |
| InChIKey | LBWQCKVDKQUYPU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|