C22H30N4O3S — CID 52570210
4-(benzenesulfonyl)-N-[3-(N-ethylanilino)propyl]piperazine-1-carboxamide (PubChem CID 52570210) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-[3-(N-ethylanilino)propyl]piperazine-1-carboxamide.
| Compound Name | 4-(benzenesulfonyl)-N-[3-(N-ethylanilino)propyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 52570210 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 4-(benzenesulfonyl)-N-[3-(N-ethylanilino)propyl]piperazine-1-carboxamide |
| SMILES | CCN(CCCNC(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H30N4O3S/c1-2-24(20-10-5-3-6-11-20)15-9-14-23-22(27)25-16-18-26(19-17-25)30(28,29)21-12-7-4-8-13-21/h3-8,10-13H,2,9,14-19H2,1H3,(H,23,27) |
| InChIKey | ZASKNPYGAVQXQD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|