C22H28ClN3O3S — CID 24550601
4-chloro-N-[3-(N-ethylanilino)propyl]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 24550601) has the molecular formula C22H28ClN3O3S and a molecular weight of 450.00 g/mol. Its IUPAC name is 4-chloro-N-[3-(N-ethylanilino)propyl]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[3-(N-ethylanilino)propyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 24550601 |
| Molecular Formula | C22H28ClN3O3S |
| Molecular Weight | 450.00 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 4-chloro-N-[3-(N-ethylanilino)propyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CCN(CCCNC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H28ClN3O3S/c1-2-25(19-9-4-3-5-10-19)14-8-13-24-22(27)18-11-12-20(23)21(17-18)30(28,29)26-15-6-7-16-26/h3-5,9-12,17H,2,6-8,13-16H2,1H3,(H,24,27) |
| InChIKey | BFZXIKYMKXHRAS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.00 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|