C23H30ClN3O3S — CID 17482722
4-chloro-N-[[2-(diethylaminomethyl)phenyl]methyl]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 17482722) has the molecular formula C23H30ClN3O3S and a molecular weight of 464.03 g/mol. Its IUPAC name is 4-chloro-N-[[2-(diethylaminomethyl)phenyl]methyl]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[[2-(diethylaminomethyl)phenyl]methyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 17482722 |
| Molecular Formula | C23H30ClN3O3S |
| Molecular Weight | 464.03 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 4-chloro-N-[[2-(diethylaminomethyl)phenyl]methyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CCN(CC)Cc1ccccc1CNC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C23H30ClN3O3S/c1-3-26(4-2)17-20-10-6-5-9-19(20)16-25-23(28)18-11-12-21(24)22(15-18)31(29,30)27-13-7-8-14-27/h5-6,9-12,15H,3-4,7-8,13-14,16-17H2,1-2H3,(H,25,28) |
| InChIKey | QNXTYFATNCQQNE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.03 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |