C24H31ClN2O3S — CID 100719790
3-(azepan-1-ylsulfonyl)-4-chloro-N-[(2,5-diethylphenyl)methyl]benzamide (PubChem CID 100719790) has the molecular formula C24H31ClN2O3S and a molecular weight of 463.04 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)-4-chloro-N-[(2,5-diethylphenyl)methyl]benzamide.
| Compound Name | 3-(azepan-1-ylsulfonyl)-4-chloro-N-[(2,5-diethylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 100719790 |
| Molecular Formula | C24H31ClN2O3S |
| Molecular Weight | 463.04 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)-4-chloro-N-[(2,5-diethylphenyl)methyl]benzamide |
| SMILES | CCc1ccc(CC)c(CNC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCCC3)c2)c1 |
| InChI | InChI=1S/C24H31ClN2O3S/c1-3-18-9-10-19(4-2)21(15-18)17-26-24(28)20-11-12-22(25)23(16-20)31(29,30)27-13-7-5-6-8-14-27/h9-12,15-16H,3-8,13-14,17H2,1-2H3,(H,26,28) |
| InChIKey | FVEROXKYSYNPOU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.04 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |