C19H22ClN3O4S — CID 24589970
4-chloro-N-[(6-methoxy-3-pyridinyl)methyl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 24589970) has the molecular formula C19H22ClN3O4S and a molecular weight of 423.92 g/mol. Its IUPAC name is 4-chloro-N-[(6-methoxy-3-pyridinyl)methyl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[(6-methoxy-3-pyridinyl)methyl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 24589970 |
| Molecular Formula | C19H22ClN3O4S |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 4-chloro-N-[(6-methoxy-3-pyridinyl)methyl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCC3)c2)cn1 |
| InChI | InChI=1S/C19H22ClN3O4S/c1-27-18-8-5-14(12-21-18)13-22-19(24)15-6-7-16(20)17(11-15)28(25,26)23-9-3-2-4-10-23/h5-8,11-12H,2-4,9-10,13H2,1H3,(H,22,24) |
| InChIKey | FRJKDBLLKDRPQH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |