C22H22N4O4 — CID 24646071
1-N,4-N-bis[(6-methoxy-3-pyridinyl)methyl]benzene-1,4-dicarboxamide (PubChem CID 24646071) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 1-N,4-N-bis[(6-methoxy-3-pyridinyl)methyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(6-methoxy-3-pyridinyl)methyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 24646071 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 1-N,4-N-bis[(6-methoxy-3-pyridinyl)methyl]benzene-1,4-dicarboxamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(C(=O)NCc3ccc(OC)nc3)cc2)cn1 |
| InChI | InChI=1S/C22H22N4O4/c1-29-19-9-3-15(11-23-19)13-25-21(27)17-5-7-18(8-6-17)22(28)26-14-16-4-10-20(30-2)24-12-16/h3-12H,13-14H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | XEASUGVRXPKNRR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |