C14H14N2O4 — CID 103955476
3,4-dihydroxy-N-[(6-methoxy-3-pyridinyl)methyl]benzamide (PubChem CID 103955476) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 3,4-dihydroxy-N-[(6-methoxy-3-pyridinyl)methyl]benzamide.
| Compound Name | 3,4-dihydroxy-N-[(6-methoxy-3-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 103955476 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3,4-dihydroxy-N-[(6-methoxy-3-pyridinyl)methyl]benzamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(O)c(O)c2)cn1 |
| InChI | InChI=1S/C14H14N2O4/c1-20-13-5-2-9(7-15-13)8-16-14(19)10-3-4-11(17)12(18)6-10/h2-7,17-18H,8H2,1H3,(H,16,19) |
| InChIKey | PKTSXNQOCODNAY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|