C17H19N3O3 — CID 16602215
N-[3-[(6-methoxy-3-pyridinyl)methylamino]-3-oxopropyl]benzamide (PubChem CID 16602215) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is N-[3-[(6-methoxy-3-pyridinyl)methylamino]-3-oxopropyl]benzamide.
| Compound Name | N-[3-[(6-methoxy-3-pyridinyl)methylamino]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 16602215 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[3-[(6-methoxy-3-pyridinyl)methylamino]-3-oxopropyl]benzamide |
| SMILES | COc1ccc(CNC(=O)CCNC(=O)c2ccccc2)cn1 |
| InChI | InChI=1S/C17H19N3O3/c1-23-16-8-7-13(12-20-16)11-19-15(21)9-10-18-17(22)14-5-3-2-4-6-14/h2-8,12H,9-11H2,1H3,(H,18,22)(H,19,21) |
| InChIKey | BCFWWNSFCKWFGU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |