C18H22N2O4 — CID 18139589
4-(4-methoxyphenoxy)-N-[(6-methoxy-3-pyridinyl)methyl]butanamide (PubChem CID 18139589) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-(4-methoxyphenoxy)-N-[(6-methoxy-3-pyridinyl)methyl]butanamide.
| Compound Name | 4-(4-methoxyphenoxy)-N-[(6-methoxy-3-pyridinyl)methyl]butanamide |
|---|---|
| PubChem CID | 18139589 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-(4-methoxyphenoxy)-N-[(6-methoxy-3-pyridinyl)methyl]butanamide |
| SMILES | COc1ccc(OCCCC(=O)NCc2ccc(OC)nc2)cc1 |
| InChI | InChI=1S/C18H22N2O4/c1-22-15-6-8-16(9-7-15)24-11-3-4-17(21)19-12-14-5-10-18(23-2)20-13-14/h5-10,13H,3-4,11-12H2,1-2H3,(H,19,21) |
| InChIKey | DCYBBKWRQHRHDN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|