C12H16N4O2 — CID 172882152
N-[(6-methoxy-3-pyridinyl)methyl]-3-(3-methyldiazirin-3-yl)propanamide (PubChem CID 172882152) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is N-[(6-methoxy-3-pyridinyl)methyl]-3-(3-methyldiazirin-3-yl)propanamide.
| Compound Name | N-[(6-methoxy-3-pyridinyl)methyl]-3-(3-methyldiazirin-3-yl)propanamide |
|---|---|
| PubChem CID | 172882152 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | N-[(6-methoxy-3-pyridinyl)methyl]-3-(3-methyldiazirin-3-yl)propanamide |
| SMILES | COc1ccc(CNC(=O)CCC2(C)N=N2)cn1 |
| InChI | InChI=1S/C12H16N4O2/c1-12(15-16-12)6-5-10(17)13-7-9-3-4-11(18-2)14-8-9/h3-4,8H,5-7H2,1-2H3,(H,13,17) |
| InChIKey | PEWOHFMYCSUBFA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |