C11H15N3O4 — CID 62992130
(2R)-2-[(6-methoxy-3-pyridinyl)methylcarbamoylamino]propanoic acid (PubChem CID 62992130) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is (2R)-2-[(6-methoxy-3-pyridinyl)methylcarbamoylamino]propanoic acid.
| Compound Name | (2R)-2-[(6-methoxy-3-pyridinyl)methylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 62992130 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (2R)-2-[(6-methoxy-3-pyridinyl)methylcarbamoylamino]propanoic acid |
| SMILES | COc1ccc(CNC(=O)N[C@H](C)C(=O)O)cn1 |
| InChI | InChI=1S/C11H15N3O4/c1-7(10(15)16)14-11(17)13-6-8-3-4-9(18-2)12-5-8/h3-5,7H,6H2,1-2H3,(H,15,16)(H2,13,14,17)/t7-/m1/s1 |
| InChIKey | JFDFJLPUVXPJNU-SSDOTTSWSA-N |
| XLogP | 0.36 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |