C11H17N3O3 — CID 106112443
3-amino-2-methoxy-N-[(6-methoxy-3-pyridinyl)methyl]propanamide (PubChem CID 106112443) has the molecular formula C11H17N3O3 and a molecular weight of 239.28 g/mol. Its IUPAC name is 3-amino-2-methoxy-N-[(6-methoxy-3-pyridinyl)methyl]propanamide.
| Compound Name | 3-amino-2-methoxy-N-[(6-methoxy-3-pyridinyl)methyl]propanamide |
|---|---|
| PubChem CID | 106112443 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 3-amino-2-methoxy-N-[(6-methoxy-3-pyridinyl)methyl]propanamide |
| SMILES | COc1ccc(CNC(=O)C(CN)OC)cn1 |
| InChI | InChI=1S/C11H17N3O3/c1-16-9(5-12)11(15)14-7-8-3-4-10(17-2)13-6-8/h3-4,6,9H,5,7,12H2,1-2H3,(H,14,15) |
| InChIKey | NSTGRXYEELVLNY-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |