C15H15FN2O3 — CID 51306226
2-(2-fluorophenoxy)-N-[(6-methoxy-3-pyridinyl)methyl]acetamide (PubChem CID 51306226) has the molecular formula C15H15FN2O3 and a molecular weight of 290.29 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-[(6-methoxy-3-pyridinyl)methyl]acetamide.
| Compound Name | 2-(2-fluorophenoxy)-N-[(6-methoxy-3-pyridinyl)methyl]acetamide |
|---|---|
| PubChem CID | 51306226 |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-[(6-methoxy-3-pyridinyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)COc2ccccc2F)cn1 |
| InChI | InChI=1S/C15H15FN2O3/c1-20-15-7-6-11(9-18-15)8-17-14(19)10-21-13-5-3-2-4-12(13)16/h2-7,9H,8,10H2,1H3,(H,17,19) |
| InChIKey | RVGLAUXNUYYMGR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |