C21H24F2N2O3S — CID 18289403
1-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-2-phenylpentan-1-one (PubChem CID 18289403) has the molecular formula C21H24F2N2O3S and a molecular weight of 422.50 g/mol. Its IUPAC name is 1-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-2-phenylpentan-1-one.
| Compound Name | 1-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-2-phenylpentan-1-one |
|---|---|
| PubChem CID | 18289403 |
| Molecular Formula | C21H24F2N2O3S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 1-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-2-phenylpentan-1-one |
| SMILES | CCCC(C(=O)N1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H24F2N2O3S/c1-2-6-18(16-7-4-3-5-8-16)21(26)24-11-13-25(14-12-24)29(27,28)20-15-17(22)9-10-19(20)23/h3-5,7-10,15,18H,2,6,11-14H2,1H3 |
| InChIKey | UBLOAYFGHXOXIZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |