C20H23F2N3O3S — CID 55411010
2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-N-(1-phenylethyl)acetamide (PubChem CID 55411010) has the molecular formula C20H23F2N3O3S and a molecular weight of 423.49 g/mol. Its IUPAC name is 2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 55411010 |
| Molecular Formula | C20H23F2N3O3S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]-N-(1-phenylethyl)acetamide |
| SMILES | CC(NC(=O)CN1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H23F2N3O3S/c1-15(16-5-3-2-4-6-16)23-20(26)14-24-9-11-25(12-10-24)29(27,28)19-13-17(21)7-8-18(19)22/h2-8,13,15H,9-12,14H2,1H3,(H,23,26) |
| InChIKey | QRZWSARSFHYMSI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |