C17H25F2N3O3S — CID 8843472
N-tert-butyl-2-[4-(2,5-difluorophenyl)sulfonyl-1,4-diazepan-1-yl]acetamide (PubChem CID 8843472) has the molecular formula C17H25F2N3O3S and a molecular weight of 389.47 g/mol. Its IUPAC name is N-tert-butyl-2-[4-(2,5-difluorophenyl)sulfonyl-1,4-diazepan-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-(2,5-difluorophenyl)sulfonyl-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 8843472 |
| Molecular Formula | C17H25F2N3O3S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | N-tert-butyl-2-[4-(2,5-difluorophenyl)sulfonyl-1,4-diazepan-1-yl]acetamide |
| SMILES | CC(C)(C)NC(=O)CN1CCCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C17H25F2N3O3S/c1-17(2,3)20-16(23)12-21-7-4-8-22(10-9-21)26(24,25)15-11-13(18)5-6-14(15)19/h5-6,11H,4,7-10,12H2,1-3H3,(H,20,23) |
| InChIKey | VDYPJFQRPTURKE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |