C19H27N5O5S — CID 24651337
N-tert-butyl-2-[4-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl]-1,4-diazepan-1-yl]acetamide (PubChem CID 24651337) has the molecular formula C19H27N5O5S and a molecular weight of 437.52 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl]-1,4-diazepan-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl]-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 24651337 |
| Molecular Formula | C19H27N5O5S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-tert-butyl-2-[4-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl]-1,4-diazepan-1-yl]acetamide |
| SMILES | CC(C)(C)NC(=O)CN1CCCN(S(=O)(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)CC1 |
| InChI | InChI=1S/C19H27N5O5S/c1-19(2,3)22-16(25)12-23-7-4-8-24(10-9-23)30(28,29)13-5-6-14-15(11-13)21-18(27)17(26)20-14/h5-6,11H,4,7-10,12H2,1-3H3,(H,20,26)(H,21,27)(H,22,25) |
| InChIKey | DTGHXFCBJOZTPX-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|