C21H22FN5O5S — CID 167975731
N-[2-[4-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl]piperazin-1-yl]ethyl]-2-fluorobenzamide (PubChem CID 167975731) has the molecular formula C21H22FN5O5S and a molecular weight of 475.50 g/mol. Its IUPAC name is N-[2-[4-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl]piperazin-1-yl]ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[4-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl]piperazin-1-yl]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 167975731 |
| Molecular Formula | C21H22FN5O5S |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | N-[2-[4-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonyl]piperazin-1-yl]ethyl]-2-fluorobenzamide |
| SMILES | O=C(NCCN1CCN(S(=O)(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)CC1)c1ccccc1F |
| InChI | InChI=1S/C21H22FN5O5S/c22-16-4-2-1-3-15(16)19(28)23-7-8-26-9-11-27(12-10-26)33(31,32)14-5-6-17-18(13-14)25-21(30)20(29)24-17/h1-6,13H,7-12H2,(H,23,28)(H,24,29)(H,25,30) |
| InChIKey | VHNPGKUQJJSNSC-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|