C17H26FN3O2 — CID 111488179
2-fluoro-N-[2-[4-[(2R)-2-hydroxybutyl]piperazin-1-yl]ethyl]benzamide (PubChem CID 111488179) has the molecular formula C17H26FN3O2 and a molecular weight of 323.41 g/mol. Its IUPAC name is 2-fluoro-N-[2-[4-[(2R)-2-hydroxybutyl]piperazin-1-yl]ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[4-[(2R)-2-hydroxybutyl]piperazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 111488179 |
| Molecular Formula | C17H26FN3O2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 2-fluoro-N-[2-[4-[(2R)-2-hydroxybutyl]piperazin-1-yl]ethyl]benzamide |
| SMILES | CC[C@@H](O)CN1CCN(CCNC(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C17H26FN3O2/c1-2-14(22)13-21-11-9-20(10-12-21)8-7-19-17(23)15-5-3-4-6-16(15)18/h3-6,14,22H,2,7-13H2,1H3,(H,19,23)/t14-/m1/s1 |
| InChIKey | REGAXMNWSZEINN-CQSZACIVSA-N |
| XLogP | 0.94 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |