C18H27FN4O2 — CID 119445980
2-fluoro-N-[3-methyl-1-oxo-1-(2-piperazin-1-ylethylamino)butan-2-yl]benzamide (PubChem CID 119445980) has the molecular formula C18H27FN4O2 and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-fluoro-N-[3-methyl-1-oxo-1-(2-piperazin-1-ylethylamino)butan-2-yl]benzamide.
| Compound Name | 2-fluoro-N-[3-methyl-1-oxo-1-(2-piperazin-1-ylethylamino)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 119445980 |
| Molecular Formula | C18H27FN4O2 |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 2-fluoro-N-[3-methyl-1-oxo-1-(2-piperazin-1-ylethylamino)butan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1F)C(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C18H27FN4O2/c1-13(2)16(22-17(24)14-5-3-4-6-15(14)19)18(25)21-9-12-23-10-7-20-8-11-23/h3-6,13,16,20H,7-12H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | ZLTPJKCLHVRCDM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |