C22H34FN3O2 — CID 55717527
2-fluoro-N-[3-methyl-1-[4-(2-methylpiperidin-1-yl)butylamino]-1-oxobutan-2-yl]benzamide (PubChem CID 55717527) has the molecular formula C22H34FN3O2 and a molecular weight of 391.53 g/mol. Its IUPAC name is 2-fluoro-N-[3-methyl-1-[4-(2-methylpiperidin-1-yl)butylamino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-fluoro-N-[3-methyl-1-[4-(2-methylpiperidin-1-yl)butylamino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 55717527 |
| Molecular Formula | C22H34FN3O2 |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 2-fluoro-N-[3-methyl-1-[4-(2-methylpiperidin-1-yl)butylamino]-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1F)C(=O)NCCCCN1CCCCC1C |
| InChI | InChI=1S/C22H34FN3O2/c1-16(2)20(25-21(27)18-11-4-5-12-19(18)23)22(28)24-13-7-9-15-26-14-8-6-10-17(26)3/h4-5,11-12,16-17,20H,6-10,13-15H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | LRRUHCTUKCLGCQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|