C17H24FN3O2 — CID 119386986
2-fluoro-N-[3-methyl-1-oxo-1-(piperidin-4-ylamino)butan-2-yl]benzamide (PubChem CID 119386986) has the molecular formula C17H24FN3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-fluoro-N-[3-methyl-1-oxo-1-(piperidin-4-ylamino)butan-2-yl]benzamide.
| Compound Name | 2-fluoro-N-[3-methyl-1-oxo-1-(piperidin-4-ylamino)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 119386986 |
| Molecular Formula | C17H24FN3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2-fluoro-N-[3-methyl-1-oxo-1-(piperidin-4-ylamino)butan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1F)C(=O)NC1CCNCC1 |
| InChI | InChI=1S/C17H24FN3O2/c1-11(2)15(17(23)20-12-7-9-19-10-8-12)21-16(22)13-5-3-4-6-14(13)18/h3-6,11-12,15,19H,7-10H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | ZYCCNRSVWOKLMA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |