C15H24ClN3O3 — CID 119390043
N-[3-methyl-1-oxo-1-(piperidin-4-ylamino)butan-2-yl]furan-2-carboxamide;hydrochloride (PubChem CID 119390043) has the molecular formula C15H24ClN3O3 and a molecular weight of 329.83 g/mol. Its IUPAC name is N-[3-methyl-1-oxo-1-(piperidin-4-ylamino)butan-2-yl]furan-2-carboxamide;hydrochloride.
| Compound Name | N-[3-methyl-1-oxo-1-(piperidin-4-ylamino)butan-2-yl]furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119390043 |
| Molecular Formula | C15H24ClN3O3 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | N-[3-methyl-1-oxo-1-(piperidin-4-ylamino)butan-2-yl]furan-2-carboxamide;hydrochloride |
| SMILES | CC(C)C(NC(=O)c1ccco1)C(=O)NC1CCNCC1.Cl |
| InChI | InChI=1S/C15H23N3O3.ClH/c1-10(2)13(18-14(19)12-4-3-9-21-12)15(20)17-11-5-7-16-8-6-11;/h3-4,9-11,13,16H,5-8H2,1-2H3,(H,17,20)(H,18,19);1H |
| InChIKey | KBRLTYRTTJLCGP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |