C14H22N2O4 — CID 110878208
N-[1-(1-hydroxybutan-2-ylamino)-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide (PubChem CID 110878208) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-[1-(1-hydroxybutan-2-ylamino)-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide.
| Compound Name | N-[1-(1-hydroxybutan-2-ylamino)-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110878208 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-[1-(1-hydroxybutan-2-ylamino)-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide |
| SMILES | CCC(CO)NC(=O)C(NC(=O)c1ccco1)C(C)C |
| InChI | InChI=1S/C14H22N2O4/c1-4-10(8-17)15-14(19)12(9(2)3)16-13(18)11-6-5-7-20-11/h5-7,9-10,12,17H,4,8H2,1-3H3,(H,15,19)(H,16,18) |
| InChIKey | JAHWLGLUUIBBGE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |