C19H24N2O3S — CID 24548221
N-[(2S)-1-(2-benzylsulfanylethylamino)-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide (PubChem CID 24548221) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-[(2S)-1-(2-benzylsulfanylethylamino)-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide.
| Compound Name | N-[(2S)-1-(2-benzylsulfanylethylamino)-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24548221 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[(2S)-1-(2-benzylsulfanylethylamino)-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccco1)C(=O)NCCSCc1ccccc1 |
| InChI | InChI=1S/C19H24N2O3S/c1-14(2)17(21-18(22)16-9-6-11-24-16)19(23)20-10-12-25-13-15-7-4-3-5-8-15/h3-9,11,14,17H,10,12-13H2,1-2H3,(H,20,23)(H,21,22)/t17-/m0/s1 |
| InChIKey | XWLLCYQGCNPMQL-KRWDZBQOSA-N |
| XLogP | 3.08 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|