C18H22N2O5 — CID 78797273
N-[1-[2-(3,4-dihydroxyphenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide (PubChem CID 78797273) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is N-[1-[2-(3,4-dihydroxyphenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide.
| Compound Name | N-[1-[2-(3,4-dihydroxyphenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 78797273 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[1-[2-(3,4-dihydroxyphenyl)ethylamino]-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide |
| SMILES | CC(C)C(NC(=O)c1ccco1)C(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H22N2O5/c1-11(2)16(20-17(23)15-4-3-9-25-15)18(24)19-8-7-12-5-6-13(21)14(22)10-12/h3-6,9-11,16,21-22H,7-8H2,1-2H3,(H,19,24)(H,20,23) |
| InChIKey | DWKVUZKZAKMUHS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|