C21H33ClN4O2 — CID 51941916
2-chloro-N-[(2S)-1-[3-(4-ethylpiperazin-1-yl)propylamino]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 51941916) has the molecular formula C21H33ClN4O2 and a molecular weight of 408.97 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-1-[3-(4-ethylpiperazin-1-yl)propylamino]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[(2S)-1-[3-(4-ethylpiperazin-1-yl)propylamino]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 51941916 |
| Molecular Formula | C21H33ClN4O2 |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 2-chloro-N-[(2S)-1-[3-(4-ethylpiperazin-1-yl)propylamino]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCN1CCN(CCCNC(=O)[C@@H](NC(=O)c2ccccc2Cl)C(C)C)CC1 |
| InChI | InChI=1S/C21H33ClN4O2/c1-4-25-12-14-26(15-13-25)11-7-10-23-21(28)19(16(2)3)24-20(27)17-8-5-6-9-18(17)22/h5-6,8-9,16,19H,4,7,10-15H2,1-3H3,(H,23,28)(H,24,27)/t19-/m0/s1 |
| InChIKey | NIIBLWOZKMYJSZ-IBGZPJMESA-N |
| XLogP | 2.24 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|