C26H36N4O2 — CID 55638967
2-methyl-N-[3-methyl-1-oxo-1-[3-(4-phenylpiperazin-1-yl)propylamino]butan-2-yl]benzamide (PubChem CID 55638967) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 2-methyl-N-[3-methyl-1-oxo-1-[3-(4-phenylpiperazin-1-yl)propylamino]butan-2-yl]benzamide.
| Compound Name | 2-methyl-N-[3-methyl-1-oxo-1-[3-(4-phenylpiperazin-1-yl)propylamino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 55638967 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 2-methyl-N-[3-methyl-1-oxo-1-[3-(4-phenylpiperazin-1-yl)propylamino]butan-2-yl]benzamide |
| SMILES | Cc1ccccc1C(=O)NC(C(=O)NCCCN1CCN(c2ccccc2)CC1)C(C)C |
| InChI | InChI=1S/C26H36N4O2/c1-20(2)24(28-25(31)23-13-8-7-10-21(23)3)26(32)27-14-9-15-29-16-18-30(19-17-29)22-11-5-4-6-12-22/h4-8,10-13,20,24H,9,14-19H2,1-3H3,(H,27,32)(H,28,31) |
| InChIKey | PXTKYNAATYQUMZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|