C28H40N4O2 — CID 55624203
2-methyl-N-[4-methyl-1-[3-[4-(3-methylphenyl)piperazin-1-yl]propylamino]-1-oxopentan-2-yl]benzamide (PubChem CID 55624203) has the molecular formula C28H40N4O2 and a molecular weight of 464.65 g/mol. Its IUPAC name is 2-methyl-N-[4-methyl-1-[3-[4-(3-methylphenyl)piperazin-1-yl]propylamino]-1-oxopentan-2-yl]benzamide.
| Compound Name | 2-methyl-N-[4-methyl-1-[3-[4-(3-methylphenyl)piperazin-1-yl]propylamino]-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 55624203 |
| Molecular Formula | C28H40N4O2 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.32 |
| IUPAC Name | 2-methyl-N-[4-methyl-1-[3-[4-(3-methylphenyl)piperazin-1-yl]propylamino]-1-oxopentan-2-yl]benzamide |
| SMILES | Cc1cccc(N2CCN(CCCNC(=O)C(CC(C)C)NC(=O)c3ccccc3C)CC2)c1 |
| InChI | InChI=1S/C28H40N4O2/c1-21(2)19-26(30-27(33)25-12-6-5-10-23(25)4)28(34)29-13-8-14-31-15-17-32(18-16-31)24-11-7-9-22(3)20-24/h5-7,9-12,20-21,26H,8,13-19H2,1-4H3,(H,29,34)(H,30,33) |
| InChIKey | RXUPYGFIKHORMO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|