C26H35ClN4O2 — CID 46402931
2-chloro-N-[3-methyl-1-[3-[4-(3-methylphenyl)piperazin-1-yl]propylamino]-1-oxobutan-2-yl]benzamide (PubChem CID 46402931) has the molecular formula C26H35ClN4O2 and a molecular weight of 471.05 g/mol. Its IUPAC name is 2-chloro-N-[3-methyl-1-[3-[4-(3-methylphenyl)piperazin-1-yl]propylamino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[3-methyl-1-[3-[4-(3-methylphenyl)piperazin-1-yl]propylamino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 46402931 |
| Molecular Formula | C26H35ClN4O2 |
| Molecular Weight | 471.05 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 2-chloro-N-[3-methyl-1-[3-[4-(3-methylphenyl)piperazin-1-yl]propylamino]-1-oxobutan-2-yl]benzamide |
| SMILES | Cc1cccc(N2CCN(CCCNC(=O)C(NC(=O)c3ccccc3Cl)C(C)C)CC2)c1 |
| InChI | InChI=1S/C26H35ClN4O2/c1-19(2)24(29-25(32)22-10-4-5-11-23(22)27)26(33)28-12-7-13-30-14-16-31(17-15-30)21-9-6-8-20(3)18-21/h4-6,8-11,18-19,24H,7,12-17H2,1-3H3,(H,28,33)(H,29,32) |
| InChIKey | CQRDQPIRUKOCPY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.05 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|