C27H33N3OS2 — CID 34250678
N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide (PubChem CID 34250678) has the molecular formula C27H33N3OS2 and a molecular weight of 479.72 g/mol. Its IUPAC name is N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 34250678 |
| Molecular Formula | C27H33N3OS2 |
| Molecular Weight | 479.72 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide |
| SMILES | Cc1cccc(N2CCN(CCCCNC(=O)c3ccccc3SCc3cccs3)CC2)c1 |
| InChI | InChI=1S/C27H33N3OS2/c1-22-8-6-9-23(20-22)30-17-15-29(16-18-30)14-5-4-13-28-27(31)25-11-2-3-12-26(25)33-21-24-10-7-19-32-24/h2-3,6-12,19-20H,4-5,13-18,21H2,1H3,(H,28,31) |
| InChIKey | HXCLVCCWJNBPTN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.72 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|