C26H31N3O2S — CID 78861956
N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]-3-(phenylsulfanylmethyl)furan-2-carboxamide (PubChem CID 78861956) has the molecular formula C26H31N3O2S and a molecular weight of 449.62 g/mol. Its IUPAC name is N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]-3-(phenylsulfanylmethyl)furan-2-carboxamide.
| Compound Name | N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]-3-(phenylsulfanylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 78861956 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]-3-(phenylsulfanylmethyl)furan-2-carboxamide |
| SMILES | Cc1cccc(N2CCN(CCCNC(=O)c3occc3CSc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C26H31N3O2S/c1-21-7-5-8-23(19-21)29-16-14-28(15-17-29)13-6-12-27-26(30)25-22(11-18-31-25)20-32-24-9-3-2-4-10-24/h2-5,7-11,18-19H,6,12-17,20H2,1H3,(H,27,30) |
| InChIKey | ZIHAHGXVAYAFHV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|