C16H21ClN2OS2 — CID 119506712
N-[2-(ethylamino)ethyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide;hydrochloride (PubChem CID 119506712) has the molecular formula C16H21ClN2OS2 and a molecular weight of 356.94 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119506712 |
| Molecular Formula | C16H21ClN2OS2 |
| Molecular Weight | 356.94 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1ccccc1SCc1cccs1.Cl |
| InChI | InChI=1S/C16H20N2OS2.ClH/c1-2-17-9-10-18-16(19)14-7-3-4-8-15(14)21-12-13-6-5-11-20-13;/h3-8,11,17H,2,9-10,12H2,1H3,(H,18,19);1H |
| InChIKey | OSFXZMDYSGPFTM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.94 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|