C23H21N3OS2 — CID 55504936
N-[2-(1-phenylpyrazol-4-yl)ethyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide (PubChem CID 55504936) has the molecular formula C23H21N3OS2 and a molecular weight of 419.58 g/mol. Its IUPAC name is N-[2-(1-phenylpyrazol-4-yl)ethyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-[2-(1-phenylpyrazol-4-yl)ethyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 55504936 |
| Molecular Formula | C23H21N3OS2 |
| Molecular Weight | 419.58 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | N-[2-(1-phenylpyrazol-4-yl)ethyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide |
| SMILES | O=C(NCCc1cnn(-c2ccccc2)c1)c1ccccc1SCc1cccs1 |
| InChI | InChI=1S/C23H21N3OS2/c27-23(21-10-4-5-11-22(21)29-17-20-9-6-14-28-20)24-13-12-18-15-25-26(16-18)19-7-2-1-3-8-19/h1-11,14-16H,12-13,17H2,(H,24,27) |
| InChIKey | DMTOUDMDEKMYJT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |