C23H21N3O2S — CID 134000854
N-[2-(1-phenylpyrazol-4-yl)ethyl]-3-(phenylsulfanylmethyl)furan-2-carboxamide (PubChem CID 134000854) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is N-[2-(1-phenylpyrazol-4-yl)ethyl]-3-(phenylsulfanylmethyl)furan-2-carboxamide.
| Compound Name | N-[2-(1-phenylpyrazol-4-yl)ethyl]-3-(phenylsulfanylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 134000854 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-[2-(1-phenylpyrazol-4-yl)ethyl]-3-(phenylsulfanylmethyl)furan-2-carboxamide |
| SMILES | O=C(NCCc1cnn(-c2ccccc2)c1)c1occc1CSc1ccccc1 |
| InChI | InChI=1S/C23H21N3O2S/c27-23(22-19(12-14-28-22)17-29-21-9-5-2-6-10-21)24-13-11-18-15-25-26(16-18)20-7-3-1-4-8-20/h1-10,12,14-16H,11,13,17H2,(H,24,27) |
| InChIKey | DXTZTQXQSNZLJK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |