C16H21ClN2O2S — CID 119497428
N-(3-aminobutyl)-3-(phenylsulfanylmethyl)furan-2-carboxamide;hydrochloride (PubChem CID 119497428) has the molecular formula C16H21ClN2O2S and a molecular weight of 340.88 g/mol. Its IUPAC name is N-(3-aminobutyl)-3-(phenylsulfanylmethyl)furan-2-carboxamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-3-(phenylsulfanylmethyl)furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119497428 |
| Molecular Formula | C16H21ClN2O2S |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-(3-aminobutyl)-3-(phenylsulfanylmethyl)furan-2-carboxamide;hydrochloride |
| SMILES | CC(N)CCNC(=O)c1occc1CSc1ccccc1.Cl |
| InChI | InChI=1S/C16H20N2O2S.ClH/c1-12(17)7-9-18-16(19)15-13(8-10-20-15)11-21-14-5-3-2-4-6-14;/h2-6,8,10,12H,7,9,11,17H2,1H3,(H,18,19);1H |
| InChIKey | HVJWYKVRLTZLTM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |