C9H14BrClN2O2 — CID 119497771
N-(3-aminobutyl)-3-bromofuran-2-carboxamide;hydrochloride (PubChem CID 119497771) has the molecular formula C9H14BrClN2O2 and a molecular weight of 297.58 g/mol. Its IUPAC name is N-(3-aminobutyl)-3-bromofuran-2-carboxamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-3-bromofuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119497771 |
| Molecular Formula | C9H14BrClN2O2 |
| Molecular Weight | 297.58 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | N-(3-aminobutyl)-3-bromofuran-2-carboxamide;hydrochloride |
| SMILES | CC(N)CCNC(=O)c1occc1Br.Cl |
| InChI | InChI=1S/C9H13BrN2O2.ClH/c1-6(11)2-4-12-9(13)8-7(10)3-5-14-8;/h3,5-6H,2,4,11H2,1H3,(H,12,13);1H |
| InChIKey | CSWLMBFXUZTIHT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.58 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |