C7H7BrN2O3 — CID 130634636
N-(2-amino-2-oxoethyl)-3-bromofuran-2-carboxamide (PubChem CID 130634636) has the molecular formula C7H7BrN2O3 and a molecular weight of 247.05 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-bromofuran-2-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-bromofuran-2-carboxamide |
|---|---|
| PubChem CID | 130634636 |
| Molecular Formula | C7H7BrN2O3 |
| Molecular Weight | 247.05 g/mol |
| Exact Mass | 245.96 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-bromofuran-2-carboxamide |
| SMILES | NC(=O)CNC(=O)c1occc1Br |
| InChI | InChI=1S/C7H7BrN2O3/c8-4-1-2-13-6(4)7(12)10-3-5(9)11/h1-2H,3H2,(H2,9,11)(H,10,12) |
| InChIKey | BNPBAPOTGAGFRB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.05 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |