C18H15F2N3O — CID 146122367
2,3-difluoro-N-[2-(1-phenylpyrazol-4-yl)ethyl]benzamide (PubChem CID 146122367) has the molecular formula C18H15F2N3O and a molecular weight of 327.33 g/mol. Its IUPAC name is 2,3-difluoro-N-[2-(1-phenylpyrazol-4-yl)ethyl]benzamide.
| Compound Name | 2,3-difluoro-N-[2-(1-phenylpyrazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 146122367 |
| Molecular Formula | C18H15F2N3O |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2,3-difluoro-N-[2-(1-phenylpyrazol-4-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1cnn(-c2ccccc2)c1)c1cccc(F)c1F |
| InChI | InChI=1S/C18H15F2N3O/c19-16-8-4-7-15(17(16)20)18(24)21-10-9-13-11-22-23(12-13)14-5-2-1-3-6-14/h1-8,11-12H,9-10H2,(H,21,24) |
| InChIKey | GLRFCJFONRWPDW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |