C22H22F2N4O2 — CID 134000738
2,4-difluoro-N-[4-oxo-4-[2-(1-phenylpyrazol-4-yl)ethylamino]butyl]benzamide (PubChem CID 134000738) has the molecular formula C22H22F2N4O2 and a molecular weight of 412.44 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-oxo-4-[2-(1-phenylpyrazol-4-yl)ethylamino]butyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-oxo-4-[2-(1-phenylpyrazol-4-yl)ethylamino]butyl]benzamide |
|---|---|
| PubChem CID | 134000738 |
| Molecular Formula | C22H22F2N4O2 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2,4-difluoro-N-[4-oxo-4-[2-(1-phenylpyrazol-4-yl)ethylamino]butyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)NCCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H22F2N4O2/c23-17-8-9-19(20(24)13-17)22(30)26-11-4-7-21(29)25-12-10-16-14-27-28(15-16)18-5-2-1-3-6-18/h1-3,5-6,8-9,13-15H,4,7,10-12H2,(H,25,29)(H,26,30) |
| InChIKey | PLGBIFDKZYKFIU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|