C20H20F2N4O2 — CID 32834586
2,4-difluoro-N-[4-(2-imidazo[1,2-a]pyridin-2-ylethylamino)-4-oxobutyl]benzamide (PubChem CID 32834586) has the molecular formula C20H20F2N4O2 and a molecular weight of 386.40 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-(2-imidazo[1,2-a]pyridin-2-ylethylamino)-4-oxobutyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-(2-imidazo[1,2-a]pyridin-2-ylethylamino)-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 32834586 |
| Molecular Formula | C20H20F2N4O2 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2,4-difluoro-N-[4-(2-imidazo[1,2-a]pyridin-2-ylethylamino)-4-oxobutyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)NCCc1cn2ccccc2n1 |
| InChI | InChI=1S/C20H20F2N4O2/c21-14-6-7-16(17(22)12-14)20(28)24-9-3-5-19(27)23-10-8-15-13-26-11-2-1-4-18(26)25-15/h1-2,4,6-7,11-13H,3,5,8-10H2,(H,23,27)(H,24,28) |
| InChIKey | KXPZIHNNXITBRG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|