C16H14FN3O — CID 25429046
4-fluoro-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)benzamide (PubChem CID 25429046) has the molecular formula C16H14FN3O and a molecular weight of 283.31 g/mol. Its IUPAC name is 4-fluoro-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)benzamide.
| Compound Name | 4-fluoro-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 25429046 |
| Molecular Formula | C16H14FN3O |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 4-fluoro-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)benzamide |
| SMILES | O=C(NCCc1cn2ccccc2n1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H14FN3O/c17-13-6-4-12(5-7-13)16(21)18-9-8-14-11-20-10-2-1-3-15(20)19-14/h1-7,10-11H,8-9H2,(H,18,21) |
| InChIKey | UCXYJBDQSQVHAY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |