C14H13N3OS — CID 32834557
N-(2-imidazo[1,2-a]pyridin-2-ylethyl)thiophene-3-carboxamide (PubChem CID 32834557) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is N-(2-imidazo[1,2-a]pyridin-2-ylethyl)thiophene-3-carboxamide.
| Compound Name | N-(2-imidazo[1,2-a]pyridin-2-ylethyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 32834557 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-(2-imidazo[1,2-a]pyridin-2-ylethyl)thiophene-3-carboxamide |
| SMILES | O=C(NCCc1cn2ccccc2n1)c1ccsc1 |
| InChI | InChI=1S/C14H13N3OS/c18-14(11-5-8-19-10-11)15-6-4-12-9-17-7-2-1-3-13(17)16-12/h1-3,5,7-10H,4,6H2,(H,15,18) |
| InChIKey | XJULPQVSESRCAK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |