C15H14BrN5O2S — CID 78858222
1-[(5-bromothiophene-2-carbonyl)amino]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)urea (PubChem CID 78858222) has the molecular formula C15H14BrN5O2S and a molecular weight of 408.28 g/mol. Its IUPAC name is 1-[(5-bromothiophene-2-carbonyl)amino]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)urea.
| Compound Name | 1-[(5-bromothiophene-2-carbonyl)amino]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)urea |
|---|---|
| PubChem CID | 78858222 |
| Molecular Formula | C15H14BrN5O2S |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 1-[(5-bromothiophene-2-carbonyl)amino]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)urea |
| SMILES | O=C(NCCc1cn2ccccc2n1)NNC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C15H14BrN5O2S/c16-12-5-4-11(24-12)14(22)19-20-15(23)17-7-6-10-9-21-8-2-1-3-13(21)18-10/h1-5,8-9H,6-7H2,(H,19,22)(H2,17,20,23) |
| InChIKey | HNQGUVVDQPOXFU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 87.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|