C18H16F3N5O2 — CID 167782875
1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-[[3-(trifluoromethyl)benzoyl]amino]urea (PubChem CID 167782875) has the molecular formula C18H16F3N5O2 and a molecular weight of 391.35 g/mol. Its IUPAC name is 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-[[3-(trifluoromethyl)benzoyl]amino]urea.
| Compound Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-[[3-(trifluoromethyl)benzoyl]amino]urea |
|---|---|
| PubChem CID | 167782875 |
| Molecular Formula | C18H16F3N5O2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-[[3-(trifluoromethyl)benzoyl]amino]urea |
| SMILES | O=C(NCCc1cn2ccccc2n1)NNC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F3N5O2/c19-18(20,21)13-5-3-4-12(10-13)16(27)24-25-17(28)22-8-7-14-11-26-9-2-1-6-15(26)23-14/h1-6,9-11H,7-8H2,(H,24,27)(H2,22,25,28) |
| InChIKey | QCBKPALLRVOAAG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 87.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|